C14H9BrCl2N2O — CID 3322799
2-bromo-N-[(2,3-dichlorophenyl)methylideneamino]benzamide (PubChem CID 3322799) has the molecular formula C14H9BrCl2N2O and a molecular weight of 372.05 g/mol. Its IUPAC name is 2-bromo-N-[(2,3-dichlorophenyl)methylideneamino]benzamide.
| Compound Name | 2-bromo-N-[(2,3-dichlorophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 3322799 |
| Molecular Formula | C14H9BrCl2N2O |
| Molecular Weight | 372.05 g/mol |
| Exact Mass | 369.93 |
| IUPAC Name | 2-bromo-N-[(2,3-dichlorophenyl)methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1cccc(Cl)c1Cl)c1ccccc1Br |
| InChI | InChI=1S/C14H9BrCl2N2O/c15-11-6-2-1-5-10(11)14(20)19-18-8-9-4-3-7-12(16)13(9)17/h1-8H,(H,19,20) |
| InChIKey | FOPHHCKDZURRMN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.05 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|