C34H43ClFNO4 — CID 3322882
2-(2-chloro-6-fluorophenyl)-1-[5,13-dihydroxy-6,10-dimethyl-5-(morpholin-4-ylmethyl)-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]ethanone (PubChem CID 3322882) has the molecular formula C34H43ClFNO4 and a molecular weight of 584.17 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1-[5,13-dihydroxy-6,10-dimethyl-5-(morpholin-4-ylmethyl)-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]ethanone.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1-[5,13-dihydroxy-6,10-dimethyl-5-(morpholin-4-ylmethyl)-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]ethanone |
|---|---|
| PubChem CID | 3322882 |
| Molecular Formula | C34H43ClFNO4 |
| Molecular Weight | 584.17 g/mol |
| Exact Mass | 583.29 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1-[5,13-dihydroxy-6,10-dimethyl-5-(morpholin-4-ylmethyl)-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]ethanone |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN2CCOCC2)c2ccc(cc2C(=O)Cc2c(F)cccc2Cl)CC(O)CC1 |
| InChI | InChI=1S/C34H43ClFNO4/c1-23-5-4-13-33(2)29(12-14-34(33,40)22-37-15-17-41-18-16-37)26-11-9-24(19-25(38)10-8-23)20-27(26)32(39)21-28-30(35)6-3-7-31(28)36/h3,5-7,9,11,20,25,29,38,40H,4,8,10,12-19,21-22H2,1-2H3 |
| InChIKey | XUJXXWJSQRNVMB-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.17 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|