C34H45F2NO6S — CID 3322884
N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(3-methoxypropyl)methanesulfonamide (PubChem CID 3322884) has the molecular formula C34H45F2NO6S and a molecular weight of 633.80 g/mol. Its IUPAC name is N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(3-methoxypropyl)methanesulfonamide.
| Compound Name | N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(3-methoxypropyl)methanesulfonamide |
|---|---|
| PubChem CID | 3322884 |
| Molecular Formula | C34H45F2NO6S |
| Molecular Weight | 633.80 g/mol |
| Exact Mass | 633.29 |
| IUPAC Name | N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(3-methoxypropyl)methanesulfonamide |
| SMILES | COCCCN(CC1(O)CCC2c3ccc(cc3C(=O)c3ccc(F)c(F)c3)CC(O)CCC(C)=CCCC21C)S(C)(=O)=O |
| InChI | InChI=1S/C34H45F2NO6S/c1-23-7-5-15-33(2)29(14-16-34(33,40)22-37(44(4,41)42)17-6-18-43-3)27-12-9-24(19-26(38)11-8-23)20-28(27)32(39)25-10-13-30(35)31(36)21-25/h7,9-10,12-13,20-21,26,29,38,40H,5-6,8,11,14-19,22H2,1-4H3 |
| InChIKey | YDWIJYCPOWEPKW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.80 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|