C16H24N4S — CID 3323342
1-[(4-tert-butylcyclohexylidene)amino]-3-pyridin-3-ylthiourea (PubChem CID 3323342) has the molecular formula C16H24N4S and a molecular weight of 304.46 g/mol. Its IUPAC name is 1-[(4-tert-butylcyclohexylidene)amino]-3-pyridin-3-ylthiourea.
| Compound Name | 1-[(4-tert-butylcyclohexylidene)amino]-3-pyridin-3-ylthiourea |
|---|---|
| PubChem CID | 3323342 |
| Molecular Formula | C16H24N4S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 1-[(4-tert-butylcyclohexylidene)amino]-3-pyridin-3-ylthiourea |
| SMILES | CC(C)(C)C1CCC(=NNC(=S)Nc2cccnc2)CC1 |
| InChI | InChI=1S/C16H24N4S/c1-16(2,3)12-6-8-13(9-7-12)19-20-15(21)18-14-5-4-10-17-11-14/h4-5,10-12H,6-9H2,1-3H3,(H2,18,20,21)/b19-13- |
| InChIKey | XXQFUALXHWDNKJ-UYRXBGFRSA-N |
| XLogP | 3.96 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|