C19H17ClFN3OS — CID 33234150
N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-2-(1-phenylimidazol-2-yl)sulfanylacetamide (PubChem CID 33234150) has the molecular formula C19H17ClFN3OS and a molecular weight of 389.88 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-2-(1-phenylimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-2-(1-phenylimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 33234150 |
| Molecular Formula | C19H17ClFN3OS |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-2-(1-phenylimidazol-2-yl)sulfanylacetamide |
| SMILES | CN(Cc1c(F)cccc1Cl)C(=O)CSc1nccn1-c1ccccc1 |
| InChI | InChI=1S/C19H17ClFN3OS/c1-23(12-15-16(20)8-5-9-17(15)21)18(25)13-26-19-22-10-11-24(19)14-6-3-2-4-7-14/h2-11H,12-13H2,1H3 |
| InChIKey | PKZKLVWVLFWEOW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |