C14H15N3O2S — CID 33236750
1-morpholin-4-yl-2-(2-pyridin-2-yl-1,3-thiazol-4-yl)ethanone (PubChem CID 33236750) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is 1-morpholin-4-yl-2-(2-pyridin-2-yl-1,3-thiazol-4-yl)ethanone.
| Compound Name | 1-morpholin-4-yl-2-(2-pyridin-2-yl-1,3-thiazol-4-yl)ethanone |
|---|---|
| PubChem CID | 33236750 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 1-morpholin-4-yl-2-(2-pyridin-2-yl-1,3-thiazol-4-yl)ethanone |
| SMILES | O=C(Cc1csc(-c2ccccn2)n1)N1CCOCC1 |
| InChI | InChI=1S/C14H15N3O2S/c18-13(17-5-7-19-8-6-17)9-11-10-20-14(16-11)12-3-1-2-4-15-12/h1-4,10H,5-9H2 |
| InChIKey | FVRNWTNECCIHMB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |