About [3-[(2,5-dichlorophenyl)sulfanylmethyl]phenyl]-morpholin-4-ylmethanone
[3-[(2,5-dichlorophenyl)sulfanylmethyl]phenyl]-morpholin-4-ylmethanone (PubChem CID 33236781) has the molecular formula C18H17Cl2NO2S
and a molecular weight of 382.31 g/mol. Its IUPAC name is [3-[(2,5-dichlorophenyl)sulfanylmethyl]phenyl]-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [3-[(2,5-dichlorophenyl)sulfanylmethyl]phenyl]-morpholin-4-ylmethanone |
| PubChem CID | 33236781 |
| Molecular Formula | C18H17Cl2NO2S |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | [3-[(2,5-dichlorophenyl)sulfanylmethyl]phenyl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cccc(CSc2cc(Cl)ccc2Cl)c1)N1CCOCC1 |
| InChI | InChI=1S/C18H17Cl2NO2S/c19-15-4-5-16(20)17(11-15)24-12-13-2-1-3-14(10-13)18(22)21-6-8-23-9-7-21/h1-5,10-11H,6-9,12H2 |
| InChIKey | AEPWSSMYNWANDR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-[(2,5-dichlorophenyl)sulfanylmethyl]phenyl]-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(2,5-dichlorophenyl)sulfanylmethyl]phenyl]-morpholin-4-ylmethanone?
The IUPAC name of [3-[(2,5-dichlorophenyl)sulfanylmethyl]phenyl]-morpholin-4-ylmethanone (CID 33236781) is [3-[(2,5-dichlorophenyl)sulfanylmethyl]phenyl]-morpholin-4-ylmethanone.
What is the SMILES notation for [3-[(2,5-dichlorophenyl)sulfanylmethyl]phenyl]-morpholin-4-ylmethanone?
The canonical SMILES for [3-[(2,5-dichlorophenyl)sulfanylmethyl]phenyl]-morpholin-4-ylmethanone is O=C(c1cccc(CSc2cc(Cl)ccc2Cl)c1)N1CCOCC1.
What is the InChIKey of [3-[(2,5-dichlorophenyl)sulfanylmethyl]phenyl]-morpholin-4-ylmethanone?
The InChIKey is AEPWSSMYNWANDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17Cl2NO2S/c19-15-4-5-16(20)17(11-15)24-12-13-2-1-3-14(10-13)18(22)21-6-8-23-9-7-21/h1-5,10-11H,6-9,12H2.
What are the key properties of [3-[(2,5-dichlorophenyl)sulfanylmethyl]phenyl]-morpholin-4-ylmethanone?
[3-[(2,5-dichlorophenyl)sulfanylmethyl]phenyl]-morpholin-4-ylmethanone has a molecular weight of 382.31 g/mol, XLogP of 4.76, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(2,5-dichlorophenyl)sulfanylmethyl]phenyl]-morpholin-4-ylmethanone is sourced from PubChem (CID 33236781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).