C18H20ClN3O6 — CID 33247967
diethyl 2-[3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]propanoylamino]propanedioate (PubChem CID 33247967) has the molecular formula C18H20ClN3O6 and a molecular weight of 409.83 g/mol. Its IUPAC name is diethyl 2-[3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]propanoylamino]propanedioate.
| Compound Name | diethyl 2-[3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]propanoylamino]propanedioate |
|---|---|
| PubChem CID | 33247967 |
| Molecular Formula | C18H20ClN3O6 |
| Molecular Weight | 409.83 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | diethyl 2-[3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]propanoylamino]propanedioate |
| SMILES | CCOC(=O)C(NC(=O)CCc1nc(-c2ccc(Cl)cc2)no1)C(=O)OCC |
| InChI | InChI=1S/C18H20ClN3O6/c1-3-26-17(24)15(18(25)27-4-2)20-13(23)9-10-14-21-16(22-28-14)11-5-7-12(19)8-6-11/h5-8,15H,3-4,9-10H2,1-2H3,(H,20,23) |
| InChIKey | TUTFKWHRUPSZTH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.83 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|