About N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]-4-propan-2-yloxybenzamide
N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]-4-propan-2-yloxybenzamide (PubChem CID 3325194) has the molecular formula C22H23N3O2S
and a molecular weight of 393.51 g/mol. Its IUPAC name is N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]-4-propan-2-yloxybenzamide.
Molecular Properties
| Compound Name | N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]-4-propan-2-yloxybenzamide |
| PubChem CID | 3325194 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]-4-propan-2-yloxybenzamide |
| SMILES | Cc1cc(C)nc(Sc2ccc(NC(=O)c3ccc(OC(C)C)cc3)cc2)n1 |
| InChI | InChI=1S/C22H23N3O2S/c1-14(2)27-19-9-5-17(6-10-19)21(26)25-18-7-11-20(12-8-18)28-22-23-15(3)13-16(4)24-22/h5-14H,1-4H3,(H,25,26) |
| InChIKey | BQKKAODDJAYDOY-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]-4-propan-2-yloxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]-4-propan-2-yloxybenzamide?
The IUPAC name of N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]-4-propan-2-yloxybenzamide (CID 3325194) is N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]-4-propan-2-yloxybenzamide.
What is the SMILES notation for N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]-4-propan-2-yloxybenzamide?
The canonical SMILES for N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]-4-propan-2-yloxybenzamide is Cc1cc(C)nc(Sc2ccc(NC(=O)c3ccc(OC(C)C)cc3)cc2)n1.
What is the InChIKey of N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]-4-propan-2-yloxybenzamide?
The InChIKey is BQKKAODDJAYDOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N3O2S/c1-14(2)27-19-9-5-17(6-10-19)21(26)25-18-7-11-20(12-8-18)28-22-23-15(3)13-16(4)24-22/h5-14H,1-4H3,(H,25,26).
What are the key properties of N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]-4-propan-2-yloxybenzamide?
N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]-4-propan-2-yloxybenzamide has a molecular weight of 393.51 g/mol, XLogP of 5.28, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]-4-propan-2-yloxybenzamide is sourced from PubChem (CID 3325194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).