C20H22N2O4 — CID 33256092
(E)-N-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 33256092) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is (E)-N-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 33256092 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (E)-N-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccc(OCC(=O)N(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H22N2O4/c1-22(2)20(24)14-26-18-11-7-16(8-12-18)21-19(23)13-6-15-4-9-17(25-3)10-5-15/h4-13H,14H2,1-3H3,(H,21,23)/b13-6+ |
| InChIKey | YYMQSJJQAFEORP-AWNIVKPZSA-N |
| XLogP | 2.81 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|