C22H27N5O3 — CID 3326050
6-imino-7-(3-methoxypropyl)-5-(4-methylpiperidine-1-carbonyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-2-one (PubChem CID 3326050) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is 6-imino-7-(3-methoxypropyl)-5-(4-methylpiperidine-1-carbonyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-2-one.
| Compound Name | 6-imino-7-(3-methoxypropyl)-5-(4-methylpiperidine-1-carbonyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-2-one |
|---|---|
| PubChem CID | 3326050 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 6-imino-7-(3-methoxypropyl)-5-(4-methylpiperidine-1-carbonyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-2-one |
| SMILES | [H]/N=c1/c(C(=O)N2CCC(C)CC2)cc2c(=O)n3ccccc3nc2n1CCCOC |
| InChI | InChI=1S/C22H27N5O3/c1-15-7-11-25(12-8-15)21(28)16-14-17-20(27(19(16)23)10-5-13-30-2)24-18-6-3-4-9-26(18)22(17)29/h3-4,6,9,14-15,23H,5,7-8,10-13H2,1-2H3/b23-19- |
| InChIKey | YBUQSXAUBIGTRV-NMWGTECJSA-N |
| XLogP | 2.04 |
| TPSA | 92.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|