About N-butan-2-yl-2,2-bis(trifluoromethyl)butanamide
N-butan-2-yl-2,2-bis(trifluoromethyl)butanamide (PubChem CID 3326094) has the molecular formula C10H15F6NO
and a molecular weight of 279.22 g/mol. Its IUPAC name is N-butan-2-yl-2,2-bis(trifluoromethyl)butanamide.
Molecular Properties
| Compound Name | N-butan-2-yl-2,2-bis(trifluoromethyl)butanamide |
| PubChem CID | 3326094 |
| Molecular Formula | C10H15F6NO |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | N-butan-2-yl-2,2-bis(trifluoromethyl)butanamide |
| SMILES | CCC(C)NC(=O)C(CC)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H15F6NO/c1-4-6(3)17-7(18)8(5-2,9(11,12)13)10(14,15)16/h6H,4-5H2,1-3H3,(H,17,18) |
| InChIKey | FEBYZYJAHQQREJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-butan-2-yl-2,2-bis(trifluoromethyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-2,2-bis(trifluoromethyl)butanamide?
The IUPAC name of N-butan-2-yl-2,2-bis(trifluoromethyl)butanamide (CID 3326094) is N-butan-2-yl-2,2-bis(trifluoromethyl)butanamide.
What is the SMILES notation for N-butan-2-yl-2,2-bis(trifluoromethyl)butanamide?
The canonical SMILES for N-butan-2-yl-2,2-bis(trifluoromethyl)butanamide is CCC(C)NC(=O)C(CC)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of N-butan-2-yl-2,2-bis(trifluoromethyl)butanamide?
The InChIKey is FEBYZYJAHQQREJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F6NO/c1-4-6(3)17-7(18)8(5-2,9(11,12)13)10(14,15)16/h6H,4-5H2,1-3H3,(H,17,18).
What are the key properties of N-butan-2-yl-2,2-bis(trifluoromethyl)butanamide?
N-butan-2-yl-2,2-bis(trifluoromethyl)butanamide has a molecular weight of 279.22 g/mol, XLogP of 3.42, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-2,2-bis(trifluoromethyl)butanamide is sourced from PubChem (CID 3326094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).