About 3-amino-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyrazine-2-carboxamide
3-amino-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyrazine-2-carboxamide (PubChem CID 33263811) has the molecular formula C11H13N5OS
and a molecular weight of 263.33 g/mol. Its IUPAC name is 3-amino-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyrazine-2-carboxamide.
Molecular Properties
| Compound Name | 3-amino-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyrazine-2-carboxamide |
| PubChem CID | 33263811 |
| Molecular Formula | C11H13N5OS |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 3-amino-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyrazine-2-carboxamide |
| SMILES | Cc1nc(CCNC(=O)c2nccnc2N)cs1 |
| InChI | InChI=1S/C11H13N5OS/c1-7-16-8(6-18-7)2-3-15-11(17)9-10(12)14-5-4-13-9/h4-6H,2-3H2,1H3,(H2,12,14)(H,15,17) |
| InChIKey | BKKXCBNDMUXAMK-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-amino-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyrazine-2-carboxamide?
The IUPAC name of 3-amino-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyrazine-2-carboxamide (CID 33263811) is 3-amino-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyrazine-2-carboxamide.
What is the SMILES notation for 3-amino-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyrazine-2-carboxamide?
The canonical SMILES for 3-amino-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyrazine-2-carboxamide is Cc1nc(CCNC(=O)c2nccnc2N)cs1.
What is the InChIKey of 3-amino-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyrazine-2-carboxamide?
The InChIKey is BKKXCBNDMUXAMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N5OS/c1-7-16-8(6-18-7)2-3-15-11(17)9-10(12)14-5-4-13-9/h4-6H,2-3H2,1H3,(H2,12,14)(H,15,17).
What are the key properties of 3-amino-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyrazine-2-carboxamide?
3-amino-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyrazine-2-carboxamide has a molecular weight of 263.33 g/mol, XLogP of 0.80, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyrazine-2-carboxamide is sourced from PubChem (CID 33263811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).