C18H16FN7OS2 — CID 33269877
5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-N-[(4-fluorophenyl)methyl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 33269877) has the molecular formula C18H16FN7OS2 and a molecular weight of 429.51 g/mol. Its IUPAC name is 5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-N-[(4-fluorophenyl)methyl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-N-[(4-fluorophenyl)methyl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 33269877 |
| Molecular Formula | C18H16FN7OS2 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | 5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-N-[(4-fluorophenyl)methyl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | Cc1cc(C)n2nc(SCc3nnc(C(=O)NCc4ccc(F)cc4)s3)nc2n1 |
| InChI | InChI=1S/C18H16FN7OS2/c1-10-7-11(2)26-17(21-10)22-18(25-26)28-9-14-23-24-16(29-14)15(27)20-8-12-3-5-13(19)6-4-12/h3-7H,8-9H2,1-2H3,(H,20,27) |
| InChIKey | PUBLUEPFEMMUAG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 97.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |