C20H17ClN4O4S2 — CID 3327851
N-(2-chloro-5-nitrophenyl)-2-[(12-oxo-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)sulfanyl]acetamide (PubChem CID 3327851) has the molecular formula C20H17ClN4O4S2 and a molecular weight of 476.97 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-2-[(12-oxo-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)sulfanyl]acetamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-2-[(12-oxo-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 3327851 |
| Molecular Formula | C20H17ClN4O4S2 |
| Molecular Weight | 476.97 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-2-[(12-oxo-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cc([N+](=O)[O-])ccc2Cl)nc2sc3c(c2c1=O)CCC3 |
| InChI | InChI=1S/C20H17ClN4O4S2/c1-2-8-24-19(27)17-12-4-3-5-15(12)31-18(17)23-20(24)30-10-16(26)22-14-9-11(25(28)29)6-7-13(14)21/h2,6-7,9H,1,3-5,8,10H2,(H,22,26) |
| InChIKey | ZULPMWVBRMQKCF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.97 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|