C19H20BrNO2 — CID 33281737
1-(4-bromophenyl)-N-[2-(2-methoxyphenyl)ethyl]cyclopropane-1-carboxamide (PubChem CID 33281737) has the molecular formula C19H20BrNO2 and a molecular weight of 374.28 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-[2-(2-methoxyphenyl)ethyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(4-bromophenyl)-N-[2-(2-methoxyphenyl)ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 33281737 |
| Molecular Formula | C19H20BrNO2 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 1-(4-bromophenyl)-N-[2-(2-methoxyphenyl)ethyl]cyclopropane-1-carboxamide |
| SMILES | COc1ccccc1CCNC(=O)C1(c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C19H20BrNO2/c1-23-17-5-3-2-4-14(17)10-13-21-18(22)19(11-12-19)15-6-8-16(20)9-7-15/h2-9H,10-13H2,1H3,(H,21,22) |
| InChIKey | KRRDTOILSXQLHP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |