C15H13N3O2 — CID 3328290
N-naphthalen-2-yl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide (PubChem CID 3328290) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is N-naphthalen-2-yl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide.
| Compound Name | N-naphthalen-2-yl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 3328290 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N-naphthalen-2-yl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide |
| SMILES | O=C1CCC(C(=O)Nc2ccc3ccccc3c2)=NN1 |
| InChI | InChI=1S/C15H13N3O2/c19-14-8-7-13(17-18-14)15(20)16-12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9H,7-8H2,(H,16,20)(H,18,19) |
| InChIKey | ZOXLPVUIBLGGEH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |