C18H14F3N3O — CID 33284080
2-[4-(2,4-difluorobenzoyl)piperazin-1-yl]-6-fluorobenzonitrile (PubChem CID 33284080) has the molecular formula C18H14F3N3O and a molecular weight of 345.32 g/mol. Its IUPAC name is 2-[4-(2,4-difluorobenzoyl)piperazin-1-yl]-6-fluorobenzonitrile.
| Compound Name | 2-[4-(2,4-difluorobenzoyl)piperazin-1-yl]-6-fluorobenzonitrile |
|---|---|
| PubChem CID | 33284080 |
| Molecular Formula | C18H14F3N3O |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 2-[4-(2,4-difluorobenzoyl)piperazin-1-yl]-6-fluorobenzonitrile |
| SMILES | N#Cc1c(F)cccc1N1CCN(C(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C18H14F3N3O/c19-12-4-5-13(16(21)10-12)18(25)24-8-6-23(7-9-24)17-3-1-2-15(20)14(17)11-22/h1-5,10H,6-9H2 |
| InChIKey | DTFNBWKAWWUNCJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |