C16H12BrIN2O2 — CID 3328426
3-(4-bromo-5-iodofuran-2-yl)-2-cyano-N-(2,3-dimethylphenyl)prop-2-enamide (PubChem CID 3328426) has the molecular formula C16H12BrIN2O2 and a molecular weight of 471.09 g/mol. Its IUPAC name is 3-(4-bromo-5-iodofuran-2-yl)-2-cyano-N-(2,3-dimethylphenyl)prop-2-enamide.
| Compound Name | 3-(4-bromo-5-iodofuran-2-yl)-2-cyano-N-(2,3-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3328426 |
| Molecular Formula | C16H12BrIN2O2 |
| Molecular Weight | 471.09 g/mol |
| Exact Mass | 469.91 |
| IUPAC Name | 3-(4-bromo-5-iodofuran-2-yl)-2-cyano-N-(2,3-dimethylphenyl)prop-2-enamide |
| SMILES | Cc1cccc(NC(=O)C(C#N)=Cc2cc(Br)c(I)o2)c1C |
| InChI | InChI=1S/C16H12BrIN2O2/c1-9-4-3-5-14(10(9)2)20-16(21)11(8-19)6-12-7-13(17)15(18)22-12/h3-7H,1-2H3,(H,20,21) |
| InChIKey | FYWXARONAGYWPW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.09 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|