C17H17F3N2O3S — CID 33284711
N-[[4-(methylsulfamoylmethyl)phenyl]methyl]-2-(trifluoromethyl)benzamide (PubChem CID 33284711) has the molecular formula C17H17F3N2O3S and a molecular weight of 386.40 g/mol. Its IUPAC name is N-[[4-(methylsulfamoylmethyl)phenyl]methyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[[4-(methylsulfamoylmethyl)phenyl]methyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 33284711 |
| Molecular Formula | C17H17F3N2O3S |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | N-[[4-(methylsulfamoylmethyl)phenyl]methyl]-2-(trifluoromethyl)benzamide |
| SMILES | CNS(=O)(=O)Cc1ccc(CNC(=O)c2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H17F3N2O3S/c1-21-26(24,25)11-13-8-6-12(7-9-13)10-22-16(23)14-4-2-3-5-15(14)17(18,19)20/h2-9,21H,10-11H2,1H3,(H,22,23) |
| InChIKey | BVXDKFUIZTXPDQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |