About 2-chloro-6-(1,2,4-triazol-1-yl)benzonitrile
2-chloro-6-(1,2,4-triazol-1-yl)benzonitrile (PubChem CID 3328680) has the molecular formula C9H5ClN4
and a molecular weight of 204.62 g/mol. Its IUPAC name is 2-chloro-6-(1,2,4-triazol-1-yl)benzonitrile.
Molecular Properties
| Compound Name | 2-chloro-6-(1,2,4-triazol-1-yl)benzonitrile |
| PubChem CID | 3328680 |
| Molecular Formula | C9H5ClN4 |
| Molecular Weight | 204.62 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 2-chloro-6-(1,2,4-triazol-1-yl)benzonitrile |
| SMILES | N#Cc1c(Cl)cccc1-n1cncn1 |
| InChI | InChI=1S/C9H5ClN4/c10-8-2-1-3-9(7(8)4-11)14-6-12-5-13-14/h1-3,5-6H |
| InChIKey | WOAFJVVJCURVIM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.62 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-6-(1,2,4-triazol-1-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-(1,2,4-triazol-1-yl)benzonitrile?
The IUPAC name of 2-chloro-6-(1,2,4-triazol-1-yl)benzonitrile (CID 3328680) is 2-chloro-6-(1,2,4-triazol-1-yl)benzonitrile.
What is the SMILES notation for 2-chloro-6-(1,2,4-triazol-1-yl)benzonitrile?
The canonical SMILES for 2-chloro-6-(1,2,4-triazol-1-yl)benzonitrile is N#Cc1c(Cl)cccc1-n1cncn1.
What is the InChIKey of 2-chloro-6-(1,2,4-triazol-1-yl)benzonitrile?
The InChIKey is WOAFJVVJCURVIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5ClN4/c10-8-2-1-3-9(7(8)4-11)14-6-12-5-13-14/h1-3,5-6H.
What are the key properties of 2-chloro-6-(1,2,4-triazol-1-yl)benzonitrile?
2-chloro-6-(1,2,4-triazol-1-yl)benzonitrile has a molecular weight of 204.62 g/mol, XLogP of 1.79, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-(1,2,4-triazol-1-yl)benzonitrile is sourced from PubChem (CID 3328680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).