C10HF8N3 — CID 3328985
2,3,5,6-tetrafluoro-N-(2,3,5,6-tetrafluoro-4-pyridinyl)pyridin-4-amine (PubChem CID 3328985) has the molecular formula C10HF8N3 and a molecular weight of 315.12 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-(2,3,5,6-tetrafluoro-4-pyridinyl)pyridin-4-amine.
| Compound Name | 2,3,5,6-tetrafluoro-N-(2,3,5,6-tetrafluoro-4-pyridinyl)pyridin-4-amine |
|---|---|
| PubChem CID | 3328985 |
| Molecular Formula | C10HF8N3 |
| Molecular Weight | 315.12 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-(2,3,5,6-tetrafluoro-4-pyridinyl)pyridin-4-amine |
| SMILES | Fc1nc(F)c(F)c(Nc2c(F)c(F)nc(F)c2F)c1F |
| InChI | InChI=1S/C10HF8N3/c11-1-5(2(12)8(16)20-7(1)15)19-6-3(13)9(17)21-10(18)4(6)14/h(H,19,20,21) |
| InChIKey | XRXVFTKDASPZRZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.12 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|