About bis(2-[3-(dimethylamino)propyliminomethyl]-4-nitrophenol);nickel(2+)
bis(2-[3-(dimethylamino)propyliminomethyl]-4-nitrophenol);nickel(2+) (PubChem CID 3329220) has the molecular formula C24H34N6NiO6+2
and a molecular weight of 561.27 g/mol. Its IUPAC name is bis(2-[3-(dimethylamino)propyliminomethyl]-4-nitrophenol);nickel(2+).
Molecular Properties
| Compound Name | bis(2-[3-(dimethylamino)propyliminomethyl]-4-nitrophenol);nickel(2+) |
| PubChem CID | 3329220 |
| Molecular Formula | C24H34N6NiO6+2 |
| Molecular Weight | 561.27 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | bis(2-[3-(dimethylamino)propyliminomethyl]-4-nitrophenol);nickel(2+) |
| SMILES | CN(C)CCC/N=C/c1cc([N+](=O)[O-])ccc1O.CN(C)CCC/N=C/c1cc([N+](=O)[O-])ccc1O.[Ni+2] |
| InChI | InChI=1S/2C12H17N3O3.Ni/c2*1-14(2)7-3-6-13-9-10-8-11(15(17)18)4-5-12(10)16;/h2*4-5,8-9,16H,3,6-7H2,1-2H3;/q;;+2/b2*13-9+; |
| InChIKey | YOXZJNAUFYDLMC-YJCYQSLBSA-N |
| XLogP | 3.34 |
| TPSA | 157.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 561.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(2-[3-(dimethylamino)propyliminomethyl]-4-nitrophenol);nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-[3-(dimethylamino)propyliminomethyl]-4-nitrophenol);nickel(2+)?
The IUPAC name of bis(2-[3-(dimethylamino)propyliminomethyl]-4-nitrophenol);nickel(2+) (CID 3329220) is bis(2-[3-(dimethylamino)propyliminomethyl]-4-nitrophenol);nickel(2+).
What is the SMILES notation for bis(2-[3-(dimethylamino)propyliminomethyl]-4-nitrophenol);nickel(2+)?
The canonical SMILES for bis(2-[3-(dimethylamino)propyliminomethyl]-4-nitrophenol);nickel(2+) is CN(C)CCC/N=C/c1cc([N+](=O)[O-])ccc1O.CN(C)CCC/N=C/c1cc([N+](=O)[O-])ccc1O.[Ni+2].
What is the InChIKey of bis(2-[3-(dimethylamino)propyliminomethyl]-4-nitrophenol);nickel(2+)?
The InChIKey is YOXZJNAUFYDLMC-YJCYQSLBSA-N. The full InChI is InChI=1S/2C12H17N3O3.Ni/c2*1-14(2)7-3-6-13-9-10-8-11(15(17)18)4-5-12(10)16;/h2*4-5,8-9,16H,3,6-7H2,1-2H3;/q;;+2/b2*13-9+;.
What are the key properties of bis(2-[3-(dimethylamino)propyliminomethyl]-4-nitrophenol);nickel(2+)?
bis(2-[3-(dimethylamino)propyliminomethyl]-4-nitrophenol);nickel(2+) has a molecular weight of 561.27 g/mol, XLogP of 3.34, 12 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-[3-(dimethylamino)propyliminomethyl]-4-nitrophenol);nickel(2+) is sourced from PubChem (CID 3329220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).