C16H15ClN2O2 — CID 3329340
2-[5-chloro-2-(2-methoxyethoxy)phenyl]-1H-benzimidazole (PubChem CID 3329340) has the molecular formula C16H15ClN2O2 and a molecular weight of 302.76 g/mol. Its IUPAC name is 2-[5-chloro-2-(2-methoxyethoxy)phenyl]-1H-benzimidazole.
| Compound Name | 2-[5-chloro-2-(2-methoxyethoxy)phenyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 3329340 |
| Molecular Formula | C16H15ClN2O2 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2-[5-chloro-2-(2-methoxyethoxy)phenyl]-1H-benzimidazole |
| SMILES | COCCOc1ccc(Cl)cc1-c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H15ClN2O2/c1-20-8-9-21-15-7-6-11(17)10-12(15)16-18-13-4-2-3-5-14(13)19-16/h2-7,10H,8-9H2,1H3,(H,18,19) |
| InChIKey | WTRDDOHONIBPSQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|