C14H11BrClN3OS — CID 33294613
3-[2-(2-bromo-4-chlorophenoxy)ethylsulfanyl]-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 33294613) has the molecular formula C14H11BrClN3OS and a molecular weight of 384.69 g/mol. Its IUPAC name is 3-[2-(2-bromo-4-chlorophenoxy)ethylsulfanyl]-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-[2-(2-bromo-4-chlorophenoxy)ethylsulfanyl]-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 33294613 |
| Molecular Formula | C14H11BrClN3OS |
| Molecular Weight | 384.69 g/mol |
| Exact Mass | 382.95 |
| IUPAC Name | 3-[2-(2-bromo-4-chlorophenoxy)ethylsulfanyl]-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | Clc1ccc(OCCSc2nnc3ccccn23)c(Br)c1 |
| InChI | InChI=1S/C14H11BrClN3OS/c15-11-9-10(16)4-5-12(11)20-7-8-21-14-18-17-13-3-1-2-6-19(13)14/h1-6,9H,7-8H2 |
| InChIKey | RMMRMDXMJAGSJM-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.69 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|