C26H27N3O3 — CID 3329595
N-(4-butylphenyl)-N'-[(4-phenylmethoxyphenyl)methylideneamino]oxamide (PubChem CID 3329595) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is N-(4-butylphenyl)-N'-[(4-phenylmethoxyphenyl)methylideneamino]oxamide.
| Compound Name | N-(4-butylphenyl)-N'-[(4-phenylmethoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 3329595 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | N-(4-butylphenyl)-N'-[(4-phenylmethoxyphenyl)methylideneamino]oxamide |
| SMILES | CCCCc1ccc(NC(=O)C(=O)NN=Cc2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H27N3O3/c1-2-3-7-20-10-14-23(15-11-20)28-25(30)26(31)29-27-18-21-12-16-24(17-13-21)32-19-22-8-5-4-6-9-22/h4-6,8-18H,2-3,7,19H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | SMBDNXOMEBRJJJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|