About 3,5-dinitrobenzohydrazide
3,5-dinitrobenzohydrazide (PubChem CID 3329932) has the molecular formula C7H6N4O5
and a molecular weight of 226.15 g/mol. Its IUPAC name is 3,5-dinitrobenzohydrazide.
Molecular Properties
| Compound Name | 3,5-dinitrobenzohydrazide |
| PubChem CID | 3329932 |
| Molecular Formula | C7H6N4O5 |
| Molecular Weight | 226.15 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 3,5-dinitrobenzohydrazide |
| SMILES | NNC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H6N4O5/c8-9-7(12)4-1-5(10(13)14)3-6(2-4)11(15)16/h1-3H,8H2,(H,9,12) |
| InChIKey | IJVPILVRNBBRSO-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 141.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.15 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dinitrobenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dinitrobenzohydrazide?
The IUPAC name of 3,5-dinitrobenzohydrazide (CID 3329932) is 3,5-dinitrobenzohydrazide.
What is the SMILES notation for 3,5-dinitrobenzohydrazide?
The canonical SMILES for 3,5-dinitrobenzohydrazide is NNC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1.
What is the InChIKey of 3,5-dinitrobenzohydrazide?
The InChIKey is IJVPILVRNBBRSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O5/c8-9-7(12)4-1-5(10(13)14)3-6(2-4)11(15)16/h1-3H,8H2,(H,9,12).
What are the key properties of 3,5-dinitrobenzohydrazide?
3,5-dinitrobenzohydrazide has a molecular weight of 226.15 g/mol, XLogP of 0.11, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dinitrobenzohydrazide is sourced from PubChem (CID 3329932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).