C6H8Cl3N5O — CID 3330529
2,2,2-trichloro-N-(2-propyltetrazol-5-yl)acetamide (PubChem CID 3330529) has the molecular formula C6H8Cl3N5O and a molecular weight of 272.52 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(2-propyltetrazol-5-yl)acetamide.
| Compound Name | 2,2,2-trichloro-N-(2-propyltetrazol-5-yl)acetamide |
|---|---|
| PubChem CID | 3330529 |
| Molecular Formula | C6H8Cl3N5O |
| Molecular Weight | 272.52 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | 2,2,2-trichloro-N-(2-propyltetrazol-5-yl)acetamide |
| SMILES | CCCn1nnc(NC(=O)C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C6H8Cl3N5O/c1-2-3-14-12-5(11-13-14)10-4(15)6(7,8)9/h2-3H2,1H3,(H,10,12,15) |
| InChIKey | LANWKJGJUVNIRU-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.52 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|