C25H30N4O3 — CID 33308938
4-(4-benzamidopiperidine-1-carbonyl)-N-phenylpiperidine-1-carboxamide (PubChem CID 33308938) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 4-(4-benzamidopiperidine-1-carbonyl)-N-phenylpiperidine-1-carboxamide.
| Compound Name | 4-(4-benzamidopiperidine-1-carbonyl)-N-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 33308938 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 4-(4-benzamidopiperidine-1-carbonyl)-N-phenylpiperidine-1-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)C2CCN(C(=O)Nc3ccccc3)CC2)CC1)c1ccccc1 |
| InChI | InChI=1S/C25H30N4O3/c30-23(19-7-3-1-4-8-19)26-22-13-17-28(18-14-22)24(31)20-11-15-29(16-12-20)25(32)27-21-9-5-2-6-10-21/h1-10,20,22H,11-18H2,(H,26,30)(H,27,32) |
| InChIKey | AKJAOIGLMRMODN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |