C19H18FNO2 — CID 33315002
(E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-[2-(4-fluorophenyl)ethyl]prop-2-enamide (PubChem CID 33315002) has the molecular formula C19H18FNO2 and a molecular weight of 311.36 g/mol. Its IUPAC name is (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-[2-(4-fluorophenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-[2-(4-fluorophenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 33315002 |
| Molecular Formula | C19H18FNO2 |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-[2-(4-fluorophenyl)ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)CCO2)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H18FNO2/c20-17-5-1-14(2-6-17)9-11-21-19(22)8-4-15-3-7-18-16(13-15)10-12-23-18/h1-8,13H,9-12H2,(H,21,22)/b8-4+ |
| InChIKey | PRQUHXIHJDGOLP-XBXARRHUSA-N |
| XLogP | 3.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|