C15H14N2O — CID 33315959
2,3-dihydroindol-1-yl-(6-methyl-2-pyridinyl)methanone (PubChem CID 33315959) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 2,3-dihydroindol-1-yl-(6-methyl-2-pyridinyl)methanone.
| Compound Name | 2,3-dihydroindol-1-yl-(6-methyl-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 33315959 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 2,3-dihydroindol-1-yl-(6-methyl-2-pyridinyl)methanone |
| SMILES | Cc1cccc(C(=O)N2CCc3ccccc32)n1 |
| InChI | InChI=1S/C15H14N2O/c1-11-5-4-7-13(16-11)15(18)17-10-9-12-6-2-3-8-14(12)17/h2-8H,9-10H2,1H3 |
| InChIKey | PTBKCQPGKYEUNT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |