C18H18N2O4 — CID 33319684
(E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]prop-2-enamide (PubChem CID 33319684) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]prop-2-enamide.
| Compound Name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 33319684 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)CCO2)NCC(=O)NCc1ccco1 |
| InChI | InChI=1S/C18H18N2O4/c21-17(20-12-18(22)19-11-15-2-1-8-23-15)6-4-13-3-5-16-14(10-13)7-9-24-16/h1-6,8,10H,7,9,11-12H2,(H,19,22)(H,20,21)/b6-4+ |
| InChIKey | FAOGBEGMOJFPSM-GQCTYLIASA-N |
| XLogP | 1.66 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|