C23H22Cl2N2O6 — CID 3332252
6a,9a-dichloro-6-(3-ethoxy-2-hydroxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3332252) has the molecular formula C23H22Cl2N2O6 and a molecular weight of 493.34 g/mol. Its IUPAC name is 6a,9a-dichloro-6-(3-ethoxy-2-hydroxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6a,9a-dichloro-6-(3-ethoxy-2-hydroxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3332252 |
| Molecular Formula | C23H22Cl2N2O6 |
| Molecular Weight | 493.34 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | 6a,9a-dichloro-6-(3-ethoxy-2-hydroxyphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CCOc1cccc(C2C3=CCC4C(=O)NC(=O)C4C3CC3(Cl)C(=O)N(C)C(=O)C23Cl)c1O |
| InChI | InChI=1S/C23H22Cl2N2O6/c1-3-33-14-6-4-5-12(17(14)28)16-10-7-8-11-15(19(30)26-18(11)29)13(10)9-22(24)20(31)27(2)21(32)23(16,22)25/h4-7,11,13,15-16,28H,3,8-9H2,1-2H3,(H,26,29,30) |
| InChIKey | OXHUYPASSIYBKL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|