About 1-(4,5-dihydro-1H-imidazol-2-yl)-3,5-diethylpyrazole
1-(4,5-dihydro-1H-imidazol-2-yl)-3,5-diethylpyrazole (PubChem CID 3332278) has the molecular formula C10H16N4
and a molecular weight of 192.27 g/mol. Its IUPAC name is 1-(4,5-dihydro-1H-imidazol-2-yl)-3,5-diethylpyrazole.
Molecular Properties
| Compound Name | 1-(4,5-dihydro-1H-imidazol-2-yl)-3,5-diethylpyrazole |
| PubChem CID | 3332278 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 1-(4,5-dihydro-1H-imidazol-2-yl)-3,5-diethylpyrazole |
| SMILES | CCc1cc(CC)n(C2=NCCN2)n1 |
| InChI | InChI=1S/C10H16N4/c1-3-8-7-9(4-2)14(13-8)10-11-5-6-12-10/h7H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | LTXGXBWHFPPXEG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4,5-dihydro-1H-imidazol-2-yl)-3,5-diethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-yl)-3,5-diethylpyrazole?
The IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-yl)-3,5-diethylpyrazole (CID 3332278) is 1-(4,5-dihydro-1H-imidazol-2-yl)-3,5-diethylpyrazole.
What is the SMILES notation for 1-(4,5-dihydro-1H-imidazol-2-yl)-3,5-diethylpyrazole?
The canonical SMILES for 1-(4,5-dihydro-1H-imidazol-2-yl)-3,5-diethylpyrazole is CCc1cc(CC)n(C2=NCCN2)n1.
What is the InChIKey of 1-(4,5-dihydro-1H-imidazol-2-yl)-3,5-diethylpyrazole?
The InChIKey is LTXGXBWHFPPXEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4/c1-3-8-7-9(4-2)14(13-8)10-11-5-6-12-10/h7H,3-6H2,1-2H3,(H,11,12).
What are the key properties of 1-(4,5-dihydro-1H-imidazol-2-yl)-3,5-diethylpyrazole?
1-(4,5-dihydro-1H-imidazol-2-yl)-3,5-diethylpyrazole has a molecular weight of 192.27 g/mol, XLogP of 0.82, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dihydro-1H-imidazol-2-yl)-3,5-diethylpyrazole is sourced from PubChem (CID 3332278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).