C36H47ClFNO5 — CID 3332577
ethyl N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylcarbamate (PubChem CID 3332577) has the molecular formula C36H47ClFNO5 and a molecular weight of 628.23 g/mol. Its IUPAC name is ethyl N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylcarbamate.
| Compound Name | ethyl N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 3332577 |
| Molecular Formula | C36H47ClFNO5 |
| Molecular Weight | 628.23 g/mol |
| Exact Mass | 627.31 |
| IUPAC Name | ethyl N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylcarbamate |
| SMILES | CCCN(CC1(O)CCC2c3ccc(cc3C(=O)Cc3c(F)cccc3Cl)CC(O)CCC(C)=CCCC21C)C(=O)OCC |
| InChI | InChI=1S/C36H47ClFNO5/c1-5-19-39(34(42)44-6-2)23-36(43)18-16-30-27-15-13-25(20-26(40)14-12-24(3)9-8-17-35(30,36)4)21-28(27)33(41)22-29-31(37)10-7-11-32(29)38/h7,9-11,13,15,21,26,30,40,43H,5-6,8,12,14,16-20,22-23H2,1-4H3 |
| InChIKey | MRSQXLZACLUAGE-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.23 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|