About ethyl 2-[[[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-(2-methylpropyl)carbamoyl]amino]acetate
ethyl 2-[[[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-(2-methylpropyl)carbamoyl]amino]acetate (PubChem CID 3332768) has the molecular formula C15H24N4O5
and a molecular weight of 340.38 g/mol. Its IUPAC name is ethyl 2-[[[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-(2-methylpropyl)carbamoyl]amino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[[[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-(2-methylpropyl)carbamoyl]amino]acetate |
| PubChem CID | 3332768 |
| Molecular Formula | C15H24N4O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | ethyl 2-[[[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-(2-methylpropyl)carbamoyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)N(CC(=O)Nc1cc(C)on1)CC(C)C |
| InChI | InChI=1S/C15H24N4O5/c1-5-23-14(21)7-16-15(22)19(8-10(2)3)9-13(20)17-12-6-11(4)24-18-12/h6,10H,5,7-9H2,1-4H3,(H,16,22)(H,17,18,20) |
| InChIKey | VATKCFSFDXGVEF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[[[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-(2-methylpropyl)carbamoyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-(2-methylpropyl)carbamoyl]amino]acetate?
The IUPAC name of ethyl 2-[[[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-(2-methylpropyl)carbamoyl]amino]acetate (CID 3332768) is ethyl 2-[[[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-(2-methylpropyl)carbamoyl]amino]acetate.
What is the SMILES notation for ethyl 2-[[[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-(2-methylpropyl)carbamoyl]amino]acetate?
The canonical SMILES for ethyl 2-[[[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-(2-methylpropyl)carbamoyl]amino]acetate is CCOC(=O)CNC(=O)N(CC(=O)Nc1cc(C)on1)CC(C)C.
What is the InChIKey of ethyl 2-[[[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-(2-methylpropyl)carbamoyl]amino]acetate?
The InChIKey is VATKCFSFDXGVEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N4O5/c1-5-23-14(21)7-16-15(22)19(8-10(2)3)9-13(20)17-12-6-11(4)24-18-12/h6,10H,5,7-9H2,1-4H3,(H,16,22)(H,17,18,20).
What are the key properties of ethyl 2-[[[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-(2-methylpropyl)carbamoyl]amino]acetate?
ethyl 2-[[[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-(2-methylpropyl)carbamoyl]amino]acetate has a molecular weight of 340.38 g/mol, XLogP of 1.15, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-(2-methylpropyl)carbamoyl]amino]acetate is sourced from PubChem (CID 3332768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).