About N-(5-chloro-2-pyridinyl)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide
N-(5-chloro-2-pyridinyl)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide (PubChem CID 33328132) has the molecular formula C12H12ClN3O2
and a molecular weight of 265.70 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide.
Molecular Properties
| Compound Name | N-(5-chloro-2-pyridinyl)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide |
| PubChem CID | 33328132 |
| Molecular Formula | C12H12ClN3O2 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide |
| SMILES | Cc1noc(C)c1CC(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C12H12ClN3O2/c1-7-10(8(2)18-16-7)5-12(17)15-11-4-3-9(13)6-14-11/h3-4,6H,5H2,1-2H3,(H,14,15,17) |
| InChIKey | DKOONELGDUNYON-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(5-chloro-2-pyridinyl)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-chloro-2-pyridinyl)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide?
The IUPAC name of N-(5-chloro-2-pyridinyl)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide (CID 33328132) is N-(5-chloro-2-pyridinyl)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide.
What is the SMILES notation for N-(5-chloro-2-pyridinyl)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide?
The canonical SMILES for N-(5-chloro-2-pyridinyl)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide is Cc1noc(C)c1CC(=O)Nc1ccc(Cl)cn1.
What is the InChIKey of N-(5-chloro-2-pyridinyl)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide?
The InChIKey is DKOONELGDUNYON-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClN3O2/c1-7-10(8(2)18-16-7)5-12(17)15-11-4-3-9(13)6-14-11/h3-4,6H,5H2,1-2H3,(H,14,15,17).
What are the key properties of N-(5-chloro-2-pyridinyl)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide?
N-(5-chloro-2-pyridinyl)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide has a molecular weight of 265.70 g/mol, XLogP of 2.52, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-chloro-2-pyridinyl)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide is sourced from PubChem (CID 33328132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).