C16H10 — CID 3333137
tetracyclo[8.6.0.03,8.011,16]hexadeca-1,3,5,7,9,11,13,15-octaene (PubChem CID 3333137) has the molecular formula C16H10 and a molecular weight of 202.26 g/mol. Its IUPAC name is tetracyclo[8.6.0.03,8.011,16]hexadeca-1,3,5,7,9,11,13,15-octaene.
| Compound Name | tetracyclo[8.6.0.03,8.011,16]hexadeca-1,3,5,7,9,11,13,15-octaene |
|---|---|
| PubChem CID | 3333137 |
| Molecular Formula | C16H10 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | tetracyclo[8.6.0.03,8.011,16]hexadeca-1,3,5,7,9,11,13,15-octaene |
| SMILES | c1ccc2c(c1)-c1cc3ccccc3cc1-2 |
| InChI | InChI=1S/C16H10/c1-2-6-12-10-16-14-8-4-3-7-13(14)15(16)9-11(12)5-1/h1-10H |
| InChIKey | QGSZQJATRLETJZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |