C25H23Cl2NO3 — CID 3333234
1,2-bis(4-chlorophenyl)-6,7-diethoxy-1,4-dihydroisoquinolin-3-one (PubChem CID 3333234) has the molecular formula C25H23Cl2NO3 and a molecular weight of 456.37 g/mol. Its IUPAC name is 1,2-bis(4-chlorophenyl)-6,7-diethoxy-1,4-dihydroisoquinolin-3-one.
| Compound Name | 1,2-bis(4-chlorophenyl)-6,7-diethoxy-1,4-dihydroisoquinolin-3-one |
|---|---|
| PubChem CID | 3333234 |
| Molecular Formula | C25H23Cl2NO3 |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 1,2-bis(4-chlorophenyl)-6,7-diethoxy-1,4-dihydroisoquinolin-3-one |
| SMILES | CCOc1cc2c(cc1OCC)C(c1ccc(Cl)cc1)N(c1ccc(Cl)cc1)C(=O)C2 |
| InChI | InChI=1S/C25H23Cl2NO3/c1-3-30-22-13-17-14-24(29)28(20-11-9-19(27)10-12-20)25(16-5-7-18(26)8-6-16)21(17)15-23(22)31-4-2/h5-13,15,25H,3-4,14H2,1-2H3 |
| InChIKey | CJEAKDMBPZVWAC-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |