C27H33N3O4 — CID 33342519
1-[3-(cyclohexanecarbonylamino)benzoyl]-N-(2-methoxyphenyl)piperidine-4-carboxamide (PubChem CID 33342519) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is 1-[3-(cyclohexanecarbonylamino)benzoyl]-N-(2-methoxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[3-(cyclohexanecarbonylamino)benzoyl]-N-(2-methoxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 33342519 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | 1-[3-(cyclohexanecarbonylamino)benzoyl]-N-(2-methoxyphenyl)piperidine-4-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1CCN(C(=O)c2cccc(NC(=O)C3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C27H33N3O4/c1-34-24-13-6-5-12-23(24)29-26(32)20-14-16-30(17-15-20)27(33)21-10-7-11-22(18-21)28-25(31)19-8-3-2-4-9-19/h5-7,10-13,18-20H,2-4,8-9,14-17H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | IQXSWUHERQTBQV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |