C18H24N4O3S — CID 3334478
2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl N-[(2-hydroxy-5-nitrophenyl)methylidene]carbamimidothioate (PubChem CID 3334478) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is 2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl N-[(2-hydroxy-5-nitrophenyl)methylidene]carbamimidothioate.
| Compound Name | 2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl N-[(2-hydroxy-5-nitrophenyl)methylidene]carbamimidothioate |
|---|---|
| PubChem CID | 3334478 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl N-[(2-hydroxy-5-nitrophenyl)methylidene]carbamimidothioate |
| SMILES | [H]/N=C(\N=Cc1cc([N+](=O)[O-])ccc1O)SCC1CCCN2CCCCC12 |
| InChI | InChI=1S/C18H24N4O3S/c19-18(20-11-14-10-15(22(24)25)6-7-17(14)23)26-12-13-4-3-9-21-8-2-1-5-16(13)21/h6-7,10-11,13,16,19,23H,1-5,8-9,12H2/b19-18+,20-11? |
| InChIKey | WLHXYODDKCAAPL-UQKTUQNUSA-N |
| XLogP | 3.65 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|