About methyl 2-[3-(2,3-dihydro-1,4-benzodioxine-3-carbonyldiazenyl)-2-hydroxyindol-1-yl]acetate
methyl 2-[3-(2,3-dihydro-1,4-benzodioxine-3-carbonyldiazenyl)-2-hydroxyindol-1-yl]acetate (PubChem CID 3335059) has the molecular formula C20H17N3O6
and a molecular weight of 395.37 g/mol. Its IUPAC name is methyl 2-[3-(2,3-dihydro-1,4-benzodioxine-3-carbonyldiazenyl)-2-hydroxyindol-1-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[3-(2,3-dihydro-1,4-benzodioxine-3-carbonyldiazenyl)-2-hydroxyindol-1-yl]acetate |
| PubChem CID | 3335059 |
| Molecular Formula | C20H17N3O6 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | methyl 2-[3-(2,3-dihydro-1,4-benzodioxine-3-carbonyldiazenyl)-2-hydroxyindol-1-yl]acetate |
| SMILES | COC(=O)Cn1c(O)c(/N=N/C(=O)C2COc3ccccc3O2)c2ccccc21 |
| InChI | InChI=1S/C20H17N3O6/c1-27-17(24)10-23-13-7-3-2-6-12(13)18(20(23)26)21-22-19(25)16-11-28-14-8-4-5-9-15(14)29-16/h2-9,16,26H,10-11H2,1H3/b22-21+ |
| InChIKey | UYNMLKAQPDBPJE-QURGRASLSA-N |
| XLogP | 2.97 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[3-(2,3-dihydro-1,4-benzodioxine-3-carbonyldiazenyl)-2-hydroxyindol-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[3-(2,3-dihydro-1,4-benzodioxine-3-carbonyldiazenyl)-2-hydroxyindol-1-yl]acetate?
The IUPAC name of methyl 2-[3-(2,3-dihydro-1,4-benzodioxine-3-carbonyldiazenyl)-2-hydroxyindol-1-yl]acetate (CID 3335059) is methyl 2-[3-(2,3-dihydro-1,4-benzodioxine-3-carbonyldiazenyl)-2-hydroxyindol-1-yl]acetate.
What is the SMILES notation for methyl 2-[3-(2,3-dihydro-1,4-benzodioxine-3-carbonyldiazenyl)-2-hydroxyindol-1-yl]acetate?
The canonical SMILES for methyl 2-[3-(2,3-dihydro-1,4-benzodioxine-3-carbonyldiazenyl)-2-hydroxyindol-1-yl]acetate is COC(=O)Cn1c(O)c(/N=N/C(=O)C2COc3ccccc3O2)c2ccccc21.
What is the InChIKey of methyl 2-[3-(2,3-dihydro-1,4-benzodioxine-3-carbonyldiazenyl)-2-hydroxyindol-1-yl]acetate?
The InChIKey is UYNMLKAQPDBPJE-QURGRASLSA-N. The full InChI is InChI=1S/C20H17N3O6/c1-27-17(24)10-23-13-7-3-2-6-12(13)18(20(23)26)21-22-19(25)16-11-28-14-8-4-5-9-15(14)29-16/h2-9,16,26H,10-11H2,1H3/b22-21+.
What are the key properties of methyl 2-[3-(2,3-dihydro-1,4-benzodioxine-3-carbonyldiazenyl)-2-hydroxyindol-1-yl]acetate?
methyl 2-[3-(2,3-dihydro-1,4-benzodioxine-3-carbonyldiazenyl)-2-hydroxyindol-1-yl]acetate has a molecular weight of 395.37 g/mol, XLogP of 2.97, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-(2,3-dihydro-1,4-benzodioxine-3-carbonyldiazenyl)-2-hydroxyindol-1-yl]acetate is sourced from PubChem (CID 3335059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).