About 2-O-ethyl 6-O-(6-methyl-3-pyridinyl) pyridine-2,6-dicarboxylate
2-O-ethyl 6-O-(6-methyl-3-pyridinyl) pyridine-2,6-dicarboxylate (PubChem CID 3335143) has the molecular formula C15H14N2O4
and a molecular weight of 286.29 g/mol. Its IUPAC name is 2-O-ethyl 6-O-(6-methyl-3-pyridinyl) pyridine-2,6-dicarboxylate.
Analyze 2-O-ethyl 6-O-(6-methyl-3-pyridinyl) pyridine-2,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-ethyl 6-O-(6-methyl-3-pyridinyl) pyridine-2,6-dicarboxylate?
The IUPAC name of 2-O-ethyl 6-O-(6-methyl-3-pyridinyl) pyridine-2,6-dicarboxylate (CID 3335143) is 2-O-ethyl 6-O-(6-methyl-3-pyridinyl) pyridine-2,6-dicarboxylate.
What is the SMILES notation for 2-O-ethyl 6-O-(6-methyl-3-pyridinyl) pyridine-2,6-dicarboxylate?
The canonical SMILES for 2-O-ethyl 6-O-(6-methyl-3-pyridinyl) pyridine-2,6-dicarboxylate is CCOC(=O)c1cccc(C(=O)Oc2ccc(C)nc2)n1.
What is the InChIKey of 2-O-ethyl 6-O-(6-methyl-3-pyridinyl) pyridine-2,6-dicarboxylate?
The InChIKey is WAYXRPJUOKERSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O4/c1-3-20-14(18)12-5-4-6-13(17-12)15(19)21-11-8-7-10(2)16-9-11/h4-9H,3H2,1-2H3.
What are the key properties of 2-O-ethyl 6-O-(6-methyl-3-pyridinyl) pyridine-2,6-dicarboxylate?
2-O-ethyl 6-O-(6-methyl-3-pyridinyl) pyridine-2,6-dicarboxylate has a molecular weight of 286.29 g/mol, XLogP of 2.18, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-ethyl 6-O-(6-methyl-3-pyridinyl) pyridine-2,6-dicarboxylate is sourced from PubChem (CID 3335143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).