About N-butan-2-yl-3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxamide
N-butan-2-yl-3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 3335209) has the molecular formula C16H18Cl2N2O3
and a molecular weight of 357.24 g/mol. Its IUPAC name is N-butan-2-yl-3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-butan-2-yl-3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxamide |
| PubChem CID | 3335209 |
| Molecular Formula | C16H18Cl2N2O3 |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | N-butan-2-yl-3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | CCC(C)NC(=O)c1c(-c2cc(Cl)c(OC)c(Cl)c2)noc1C |
| InChI | InChI=1S/C16H18Cl2N2O3/c1-5-8(2)19-16(21)13-9(3)23-20-14(13)10-6-11(17)15(22-4)12(18)7-10/h6-8H,5H2,1-4H3,(H,19,21) |
| InChIKey | SBQZGUJLKHCUAP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-butan-2-yl-3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxamide?
The IUPAC name of N-butan-2-yl-3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxamide (CID 3335209) is N-butan-2-yl-3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxamide.
What is the SMILES notation for N-butan-2-yl-3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxamide?
The canonical SMILES for N-butan-2-yl-3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxamide is CCC(C)NC(=O)c1c(-c2cc(Cl)c(OC)c(Cl)c2)noc1C.
What is the InChIKey of N-butan-2-yl-3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxamide?
The InChIKey is SBQZGUJLKHCUAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18Cl2N2O3/c1-5-8(2)19-16(21)13-9(3)23-20-14(13)10-6-11(17)15(22-4)12(18)7-10/h6-8H,5H2,1-4H3,(H,19,21).
What are the key properties of N-butan-2-yl-3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxamide?
N-butan-2-yl-3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxamide has a molecular weight of 357.24 g/mol, XLogP of 4.49, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxamide is sourced from PubChem (CID 3335209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).