C19H25N5O2S — CID 33354863
4-[[cyclopropyl-[2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetyl]amino]methyl]-N-methylbenzamide (PubChem CID 33354863) has the molecular formula C19H25N5O2S and a molecular weight of 387.51 g/mol. Its IUPAC name is 4-[[cyclopropyl-[2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetyl]amino]methyl]-N-methylbenzamide.
| Compound Name | 4-[[cyclopropyl-[2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetyl]amino]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 33354863 |
| Molecular Formula | C19H25N5O2S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 4-[[cyclopropyl-[2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetyl]amino]methyl]-N-methylbenzamide |
| SMILES | CCCc1n[nH]c(=S)n1CC(=O)N(Cc1ccc(C(=O)NC)cc1)C1CC1 |
| InChI | InChI=1S/C19H25N5O2S/c1-3-4-16-21-22-19(27)24(16)12-17(25)23(15-9-10-15)11-13-5-7-14(8-6-13)18(26)20-2/h5-8,15H,3-4,9-12H2,1-2H3,(H,20,26)(H,22,27) |
| InChIKey | JMWVZAIEWCSMPS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 83.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|