C15H14N4O3 — CID 33356226
N-[(1R)-1-(4-cyanophenyl)ethyl]-2-(2,4-dioxopyrimidin-1-yl)acetamide (PubChem CID 33356226) has the molecular formula C15H14N4O3 and a molecular weight of 298.30 g/mol. Its IUPAC name is N-[(1R)-1-(4-cyanophenyl)ethyl]-2-(2,4-dioxopyrimidin-1-yl)acetamide.
| Compound Name | N-[(1R)-1-(4-cyanophenyl)ethyl]-2-(2,4-dioxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 33356226 |
| Molecular Formula | C15H14N4O3 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N-[(1R)-1-(4-cyanophenyl)ethyl]-2-(2,4-dioxopyrimidin-1-yl)acetamide |
| SMILES | C[C@@H](NC(=O)Cn1ccc(=O)[nH]c1=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C15H14N4O3/c1-10(12-4-2-11(8-16)3-5-12)17-14(21)9-19-7-6-13(20)18-15(19)22/h2-7,10H,9H2,1H3,(H,17,21)(H,18,20,22)/t10-/m1/s1 |
| InChIKey | WQTABVCUCXFELX-SNVBAGLBSA-N |
| XLogP | 0.29 |
| TPSA | 107.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |