C22H21N3O3 — CID 33365935
(4-methoxyphenyl)-[1-(quinoxaline-2-carbonyl)piperidin-4-yl]methanone (PubChem CID 33365935) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is (4-methoxyphenyl)-[1-(quinoxaline-2-carbonyl)piperidin-4-yl]methanone.
| Compound Name | (4-methoxyphenyl)-[1-(quinoxaline-2-carbonyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 33365935 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | (4-methoxyphenyl)-[1-(quinoxaline-2-carbonyl)piperidin-4-yl]methanone |
| SMILES | COc1ccc(C(=O)C2CCN(C(=O)c3cnc4ccccc4n3)CC2)cc1 |
| InChI | InChI=1S/C22H21N3O3/c1-28-17-8-6-15(7-9-17)21(26)16-10-12-25(13-11-16)22(27)20-14-23-18-4-2-3-5-19(18)24-20/h2-9,14,16H,10-13H2,1H3 |
| InChIKey | BSYBRKQQADEAEB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |