About 4-oxo-N-[2-(2,2,2-trifluoroethoxy)phenyl]-3H-phthalazine-1-carboxamide
4-oxo-N-[2-(2,2,2-trifluoroethoxy)phenyl]-3H-phthalazine-1-carboxamide (PubChem CID 33369765) has the molecular formula C17H12F3N3O3
and a molecular weight of 363.30 g/mol. Its IUPAC name is 4-oxo-N-[2-(2,2,2-trifluoroethoxy)phenyl]-3H-phthalazine-1-carboxamide.
Molecular Properties
| Compound Name | 4-oxo-N-[2-(2,2,2-trifluoroethoxy)phenyl]-3H-phthalazine-1-carboxamide |
| PubChem CID | 33369765 |
| Molecular Formula | C17H12F3N3O3 |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 4-oxo-N-[2-(2,2,2-trifluoroethoxy)phenyl]-3H-phthalazine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1OCC(F)(F)F)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C17H12F3N3O3/c18-17(19,20)9-26-13-8-4-3-7-12(13)21-16(25)14-10-5-1-2-6-11(10)15(24)23-22-14/h1-8H,9H2,(H,21,25)(H,23,24) |
| InChIKey | ZHWSORVRLXXLIV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-oxo-N-[2-(2,2,2-trifluoroethoxy)phenyl]-3H-phthalazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-N-[2-(2,2,2-trifluoroethoxy)phenyl]-3H-phthalazine-1-carboxamide?
The IUPAC name of 4-oxo-N-[2-(2,2,2-trifluoroethoxy)phenyl]-3H-phthalazine-1-carboxamide (CID 33369765) is 4-oxo-N-[2-(2,2,2-trifluoroethoxy)phenyl]-3H-phthalazine-1-carboxamide.
What is the SMILES notation for 4-oxo-N-[2-(2,2,2-trifluoroethoxy)phenyl]-3H-phthalazine-1-carboxamide?
The canonical SMILES for 4-oxo-N-[2-(2,2,2-trifluoroethoxy)phenyl]-3H-phthalazine-1-carboxamide is O=C(Nc1ccccc1OCC(F)(F)F)c1n[nH]c(=O)c2ccccc12.
What is the InChIKey of 4-oxo-N-[2-(2,2,2-trifluoroethoxy)phenyl]-3H-phthalazine-1-carboxamide?
The InChIKey is ZHWSORVRLXXLIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12F3N3O3/c18-17(19,20)9-26-13-8-4-3-7-12(13)21-16(25)14-10-5-1-2-6-11(10)15(24)23-22-14/h1-8H,9H2,(H,21,25)(H,23,24).
What are the key properties of 4-oxo-N-[2-(2,2,2-trifluoroethoxy)phenyl]-3H-phthalazine-1-carboxamide?
4-oxo-N-[2-(2,2,2-trifluoroethoxy)phenyl]-3H-phthalazine-1-carboxamide has a molecular weight of 363.30 g/mol, XLogP of 3.12, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-N-[2-(2,2,2-trifluoroethoxy)phenyl]-3H-phthalazine-1-carboxamide is sourced from PubChem (CID 33369765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).