C10H10N4O4S2 — CID 3337421
2-(2,4-dioxo-1,3-thiazolidin-5-yl)-N-[3-(2-oxopropyl)-1,2,4-thiadiazol-5-yl]acetamide (PubChem CID 3337421) has the molecular formula C10H10N4O4S2 and a molecular weight of 314.35 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-thiazolidin-5-yl)-N-[3-(2-oxopropyl)-1,2,4-thiadiazol-5-yl]acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-thiazolidin-5-yl)-N-[3-(2-oxopropyl)-1,2,4-thiadiazol-5-yl]acetamide |
|---|---|
| PubChem CID | 3337421 |
| Molecular Formula | C10H10N4O4S2 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 2-(2,4-dioxo-1,3-thiazolidin-5-yl)-N-[3-(2-oxopropyl)-1,2,4-thiadiazol-5-yl]acetamide |
| SMILES | CC(=O)Cc1nsc(NC(=O)CC2SC(=O)NC2=O)n1 |
| InChI | InChI=1S/C10H10N4O4S2/c1-4(15)2-6-11-9(20-14-6)12-7(16)3-5-8(17)13-10(18)19-5/h5H,2-3H2,1H3,(H,13,17,18)(H,11,12,14,16) |
| InChIKey | OMJZWZCDTZSBSN-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|