C13H8ClN3O2S — CID 3337765
N-(2-chloro-3-pyridinyl)-5-thiophen-2-yl-1,2-oxazole-3-carboxamide (PubChem CID 3337765) has the molecular formula C13H8ClN3O2S and a molecular weight of 305.75 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-5-thiophen-2-yl-1,2-oxazole-3-carboxamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-5-thiophen-2-yl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 3337765 |
| Molecular Formula | C13H8ClN3O2S |
| Molecular Weight | 305.75 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-5-thiophen-2-yl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(Nc1cccnc1Cl)c1cc(-c2cccs2)on1 |
| InChI | InChI=1S/C13H8ClN3O2S/c14-12-8(3-1-5-15-12)16-13(18)9-7-10(19-17-9)11-4-2-6-20-11/h1-7H,(H,16,18) |
| InChIKey | IHGUDQDSYDNPIL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.75 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|